C14H21BrN2O3 — CID 120500013
3-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methylbutanamide (PubChem CID 120500013) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 3-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methylbutanamide.
| Compound Name | 3-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 120500013 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methylbutanamide |
| SMILES | COc1cc(CNC(=O)C(C)C(C)N)cc(Br)c1OC |
| InChI | InChI=1S/C14H21BrN2O3/c1-8(9(2)16)14(18)17-7-10-5-11(15)13(20-4)12(6-10)19-3/h5-6,8-9H,7,16H2,1-4H3,(H,17,18) |
| InChIKey | JKFBXWCXUCAJSD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |