C21H26O6S2 — CID 54048367
(2S,4S)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dithiolane (PubChem CID 54048367) has the molecular formula C21H26O6S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is (2S,4S)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dithiolane.
| Compound Name | (2S,4S)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 54048367 |
| Molecular Formula | C21H26O6S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (2S,4S)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dithiolane |
| SMILES | COc1cc([C@H]2SC[C@H](c3cc(OC)c(OC)c(OC)c3)S2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26O6S2/c1-22-14-7-12(8-15(23-2)19(14)26-5)18-11-28-21(29-18)13-9-16(24-3)20(27-6)17(10-13)25-4/h7-10,18,21H,11H2,1-6H3/t18-,21+/m1/s1 |
| InChIKey | LRDPHWHZGQMHGZ-NQIIRXRSSA-N |
| XLogP | 4.96 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |