C50H72O10 — CID 86346201
ethyl 4-[7-(4-ethoxy-4-oxobutoxy)-3,6,10,11-tetrapentoxytriphenylen-2-yl]oxybutanoate (PubChem CID 86346201) has the molecular formula C50H72O10 and a molecular weight of 833.12 g/mol. Its IUPAC name is ethyl 4-[7-(4-ethoxy-4-oxobutoxy)-3,6,10,11-tetrapentoxytriphenylen-2-yl]oxybutanoate.
| Compound Name | ethyl 4-[7-(4-ethoxy-4-oxobutoxy)-3,6,10,11-tetrapentoxytriphenylen-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 86346201 |
| Molecular Formula | C50H72O10 |
| Molecular Weight | 833.12 g/mol |
| Exact Mass | 832.51 |
| IUPAC Name | ethyl 4-[7-(4-ethoxy-4-oxobutoxy)-3,6,10,11-tetrapentoxytriphenylen-2-yl]oxybutanoate |
| SMILES | CCCCCOc1cc2c(cc1OCCCCC)c1cc(OCCCC(=O)OCC)c(OCCCCC)cc1c1cc(OCCCCC)c(OCCCC(=O)OCC)cc21 |
| InChI | InChI=1S/C50H72O10/c1-7-13-17-25-55-43-31-37-38(32-44(43)56-26-18-14-8-2)42-36-48(60-30-22-24-50(52)54-12-6)46(58-28-20-16-10-4)34-40(42)39-33-45(57-27-19-15-9-3)47(35-41(37)39)59-29-21-23-49(51)53-11-5/h31-36H,7-30H2,1-6H3 |
| InChIKey | HJYGFXKAYJDLQI-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.12 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|