C58H88O10 — CID 101162406
8-[3-(7-carboxyheptoxy)-6,7,10,11-tetrahexoxytriphenylen-2-yl]oxyoctanoic acid (PubChem CID 101162406) has the molecular formula C58H88O10 and a molecular weight of 945.33 g/mol. Its IUPAC name is 8-[3-(7-carboxyheptoxy)-6,7,10,11-tetrahexoxytriphenylen-2-yl]oxyoctanoic acid.
| Compound Name | 8-[3-(7-carboxyheptoxy)-6,7,10,11-tetrahexoxytriphenylen-2-yl]oxyoctanoic acid |
|---|---|
| PubChem CID | 101162406 |
| Molecular Formula | C58H88O10 |
| Molecular Weight | 945.33 g/mol |
| Exact Mass | 944.64 |
| IUPAC Name | 8-[3-(7-carboxyheptoxy)-6,7,10,11-tetrahexoxytriphenylen-2-yl]oxyoctanoic acid |
| SMILES | CCCCCCOc1cc2c3cc(OCCCCCC)c(OCCCCCC)cc3c3cc(OCCCCCCCC(=O)O)c(OCCCCCCCC(=O)O)cc3c2cc1OCCCCCC |
| InChI | InChI=1S/C58H88O10/c1-5-9-13-25-33-63-51-39-45-46-40-52(64-34-26-14-10-6-2)54(66-36-28-16-12-8-4)42-48(46)50-44-56(68-38-30-22-18-20-24-32-58(61)62)55(67-37-29-21-17-19-23-31-57(59)60)43-49(50)47(45)41-53(51)65-35-27-15-11-7-3/h39-44H,5-38H2,1-4H3,(H,59,60)(H,61,62) |
| InChIKey | DDWZBHULYZDKDJ-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.33 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|