C52H76O8 — CID 101357364
5-[3-(4-carboxybutyl)-6,7,10,11-tetrahexoxytriphenylen-2-yl]pentanoic acid (PubChem CID 101357364) has the molecular formula C52H76O8 and a molecular weight of 829.17 g/mol. Its IUPAC name is 5-[3-(4-carboxybutyl)-6,7,10,11-tetrahexoxytriphenylen-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-carboxybutyl)-6,7,10,11-tetrahexoxytriphenylen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 101357364 |
| Molecular Formula | C52H76O8 |
| Molecular Weight | 829.17 g/mol |
| Exact Mass | 828.55 |
| IUPAC Name | 5-[3-(4-carboxybutyl)-6,7,10,11-tetrahexoxytriphenylen-2-yl]pentanoic acid |
| SMILES | CCCCCCOc1cc2c3cc(CCCCC(=O)O)c(CCCCC(=O)O)cc3c3cc(OCCCCCC)c(OCCCCCC)cc3c2cc1OCCCCCC |
| InChI | InChI=1S/C52H76O8/c1-5-9-13-21-29-57-47-35-43-41-33-39(25-17-19-27-51(53)54)40(26-18-20-28-52(55)56)34-42(41)44-36-48(58-30-22-14-10-6-2)50(60-32-24-16-12-8-4)38-46(44)45(43)37-49(47)59-31-23-15-11-7-3/h33-38H,5-32H2,1-4H3,(H,53,54)(H,55,56) |
| InChIKey | QJZLKBUOMLBCHO-UHFFFAOYSA-N |
| XLogP | 14.58 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.17 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|