C32H54O5 — CID 151006342
10-[2-(9-carboxynonyl)-3-hexoxyphenyl]decanoic acid (PubChem CID 151006342) has the molecular formula C32H54O5 and a molecular weight of 518.78 g/mol. Its IUPAC name is 10-[2-(9-carboxynonyl)-3-hexoxyphenyl]decanoic acid.
| Compound Name | 10-[2-(9-carboxynonyl)-3-hexoxyphenyl]decanoic acid |
|---|---|
| PubChem CID | 151006342 |
| Molecular Formula | C32H54O5 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | 10-[2-(9-carboxynonyl)-3-hexoxyphenyl]decanoic acid |
| SMILES | CCCCCCOc1cccc(CCCCCCCCCC(=O)O)c1CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C32H54O5/c1-2-3-4-19-27-37-30-24-20-22-28(21-15-11-7-5-9-13-17-25-31(33)34)29(30)23-16-12-8-6-10-14-18-26-32(35)36/h20,22,24H,2-19,21,23,25-27H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | LVDYQPVZPZVWPD-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|