C33H56O4 — CID 151550347
10-[2-(9-carboxynonyl)-3-heptylphenyl]decanoic acid (PubChem CID 151550347) has the molecular formula C33H56O4 and a molecular weight of 516.81 g/mol. Its IUPAC name is 10-[2-(9-carboxynonyl)-3-heptylphenyl]decanoic acid.
| Compound Name | 10-[2-(9-carboxynonyl)-3-heptylphenyl]decanoic acid |
|---|---|
| PubChem CID | 151550347 |
| Molecular Formula | C33H56O4 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | 10-[2-(9-carboxynonyl)-3-heptylphenyl]decanoic acid |
| SMILES | CCCCCCCc1cccc(CCCCCCCCCC(=O)O)c1CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C33H56O4/c1-2-3-4-11-16-22-29-24-21-25-30(23-17-12-7-5-9-14-19-27-32(34)35)31(29)26-18-13-8-6-10-15-20-28-33(36)37/h21,24-25H,2-20,22-23,26-28H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | QAIVEUJPDMCXHZ-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|