C30H56O4S — CID 172814095
sulfuric acid;1,2,3-trioctylbenzene (PubChem CID 172814095) has the molecular formula C30H56O4S and a molecular weight of 512.84 g/mol. Its IUPAC name is sulfuric acid;1,2,3-trioctylbenzene.
| Compound Name | sulfuric acid;1,2,3-trioctylbenzene |
|---|---|
| PubChem CID | 172814095 |
| Molecular Formula | C30H56O4S |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | sulfuric acid;1,2,3-trioctylbenzene |
| SMILES | CCCCCCCCc1cccc(CCCCCCCC)c1CCCCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C30H54.H2O4S/c1-4-7-10-13-16-19-23-28-25-22-26-29(24-20-17-14-11-8-5-2)30(28)27-21-18-15-12-9-6-3;1-5(2,3)4/h22,25-26H,4-21,23-24,27H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | SOTJTARLPLQFSR-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|