C31H52O4 — CID 152622243
10-[2-(9-carboxynonyl)-3-pentylphenyl]decanoic acid (PubChem CID 152622243) has the molecular formula C31H52O4 and a molecular weight of 488.75 g/mol. Its IUPAC name is 10-[2-(9-carboxynonyl)-3-pentylphenyl]decanoic acid.
| Compound Name | 10-[2-(9-carboxynonyl)-3-pentylphenyl]decanoic acid |
|---|---|
| PubChem CID | 152622243 |
| Molecular Formula | C31H52O4 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | 10-[2-(9-carboxynonyl)-3-pentylphenyl]decanoic acid |
| SMILES | CCCCCc1cccc(CCCCCCCCCC(=O)O)c1CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C31H52O4/c1-2-3-14-20-27-22-19-23-28(21-15-10-6-4-8-12-17-25-30(32)33)29(27)24-16-11-7-5-9-13-18-26-31(34)35/h19,22-23H,2-18,20-21,24-26H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | ZBTNTTZNSUUONG-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|