C24H38O6 — CID 19922033
3-[2-(6-hydroxyhexyl)-6-(8-methoxy-8-oxooctoxy)phenyl]propanoic acid (PubChem CID 19922033) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is 3-[2-(6-hydroxyhexyl)-6-(8-methoxy-8-oxooctoxy)phenyl]propanoic acid.
| Compound Name | 3-[2-(6-hydroxyhexyl)-6-(8-methoxy-8-oxooctoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19922033 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-[2-(6-hydroxyhexyl)-6-(8-methoxy-8-oxooctoxy)phenyl]propanoic acid |
| SMILES | COC(=O)CCCCCCCOc1cccc(CCCCCCO)c1CCC(=O)O |
| InChI | InChI=1S/C24H38O6/c1-29-24(28)15-8-3-2-6-10-19-30-22-14-11-13-20(12-7-4-5-9-18-25)21(22)16-17-23(26)27/h11,13-14,25H,2-10,12,15-19H2,1H3,(H,26,27) |
| InChIKey | OSJCGGRRXYZACM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|