C38H42O7 — CID 46928984
4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-phenylmethoxyphenoxy)hexyl]phenoxy]butanoic acid (PubChem CID 46928984) has the molecular formula C38H42O7 and a molecular weight of 610.75 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-phenylmethoxyphenoxy)hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-phenylmethoxyphenoxy)hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46928984 |
| Molecular Formula | C38H42O7 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-phenylmethoxyphenoxy)hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(OCc3ccccc3)cc(-c3ccccc3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C38H42O7/c39-37(40)20-12-24-44-36-19-11-18-31(35(36)21-22-38(41)42)17-7-1-2-10-23-43-33-25-32(30-15-8-4-9-16-30)26-34(27-33)45-28-29-13-5-3-6-14-29/h3-6,8-9,11,13-16,18-19,25-27H,1-2,7,10,12,17,20-24,28H2,(H,39,40)(H,41,42) |
| InChIKey | MLUPRFUYPSAATH-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|