C34H36F2O9 — CID 46929167
4-[3-[6-[3-acetyl-5-(2,2-difluoro-1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 46929167) has the molecular formula C34H36F2O9 and a molecular weight of 626.65 g/mol. Its IUPAC name is 4-[3-[6-[3-acetyl-5-(2,2-difluoro-1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-acetyl-5-(2,2-difluoro-1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46929167 |
| Molecular Formula | C34H36F2O9 |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | 4-[3-[6-[3-acetyl-5-(2,2-difluoro-1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | CC(=O)c1cc(OCCCCCCc2cccc(OCCCC(=O)O)c2CCC(=O)O)cc(-c2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C34H36F2O9/c1-22(37)25-18-26(24-12-14-30-31(21-24)45-34(35,36)44-30)20-27(19-25)42-16-5-3-2-4-8-23-9-6-10-29(28(23)13-15-33(40)41)43-17-7-11-32(38)39/h6,9-10,12,14,18-21H,2-5,7-8,11,13,15-17H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | OQIXOJZOYXNRBI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|