C38H46N2O9 — CID 67338473
4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(1,4-diazepane-1-carbonyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 67338473) has the molecular formula C38H46N2O9 and a molecular weight of 674.79 g/mol. Its IUPAC name is 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(1,4-diazepane-1-carbonyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(1,4-diazepane-1-carbonyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67338473 |
| Molecular Formula | C38H46N2O9 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(1,4-diazepane-1-carbonyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(C(=O)N3CCCNCC3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O |
| InChI | InChI=1S/C38H46N2O9/c41-36(42)11-6-21-47-33-10-5-9-27(32(33)13-15-37(43)44)8-3-1-2-4-20-46-31-23-29(28-12-14-34-35(25-28)49-26-48-34)22-30(24-31)38(45)40-18-7-16-39-17-19-40/h5,9-10,12,14,22-25,39H,1-4,6-8,11,13,15-21,26H2,(H,41,42)(H,43,44) |
| InChIKey | DVYMBHPVHPUGKF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|