C35H44N2O8 — CID 67338888
4-[2-(2-carboxyethyl)-3-[6-[3-(furan-3-yl)-5-(4-methylpiperazine-1-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid (PubChem CID 67338888) has the molecular formula C35H44N2O8 and a molecular weight of 620.74 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-[3-(furan-3-yl)-5-(4-methylpiperazine-1-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(furan-3-yl)-5-(4-methylpiperazine-1-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67338888 |
| Molecular Formula | C35H44N2O8 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(furan-3-yl)-5-(4-methylpiperazine-1-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid |
| SMILES | CN1CCN(C(=O)c2cc(OCCCCCCc3cccc(OCCCC(=O)O)c3CCC(=O)O)cc(-c3ccoc3)c2)CC1 |
| InChI | InChI=1S/C35H44N2O8/c1-36-15-17-37(18-16-36)35(42)29-22-28(27-14-21-43-25-27)23-30(24-29)44-19-5-3-2-4-8-26-9-6-10-32(31(26)12-13-34(40)41)45-20-7-11-33(38)39/h6,9-10,14,21-25H,2-5,7-8,11-13,15-20H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | IFTXNGOAIXMINT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|