C40H46FNO6 — CID 25192324
4-[2-(2-carboxyethyl)-3-[6-[3-[4-(dimethylamino)phenyl]-5-(4-fluoro-3-methylphenyl)phenoxy]hexyl]phenoxy]butanoic acid (PubChem CID 25192324) has the molecular formula C40H46FNO6 and a molecular weight of 655.81 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-[3-[4-(dimethylamino)phenyl]-5-(4-fluoro-3-methylphenyl)phenoxy]hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-[3-[4-(dimethylamino)phenyl]-5-(4-fluoro-3-methylphenyl)phenoxy]hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 25192324 |
| Molecular Formula | C40H46FNO6 |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.33 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-[3-[4-(dimethylamino)phenyl]-5-(4-fluoro-3-methylphenyl)phenoxy]hexyl]phenoxy]butanoic acid |
| SMILES | Cc1cc(-c2cc(OCCCCCCc3cccc(OCCCC(=O)O)c3CCC(=O)O)cc(-c3ccc(N(C)C)cc3)c2)ccc1F |
| InChI | InChI=1S/C40H46FNO6/c1-28-24-31(16-20-37(28)41)33-25-32(29-14-17-34(18-15-29)42(2)3)26-35(27-33)47-22-7-5-4-6-10-30-11-8-12-38(36(30)19-21-40(45)46)48-23-9-13-39(43)44/h8,11-12,14-18,20,24-27H,4-7,9-10,13,19,21-23H2,1-3H3,(H,43,44)(H,45,46) |
| InChIKey | WIEQUZWSBBKACU-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|