C33H38O9 — CID 46929336
4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(hydroxymethyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 46929336) has the molecular formula C33H38O9 and a molecular weight of 578.66 g/mol. Its IUPAC name is 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(hydroxymethyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(hydroxymethyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46929336 |
| Molecular Formula | C33H38O9 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-(hydroxymethyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(CO)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O |
| InChI | InChI=1S/C33H38O9/c34-21-23-17-26(25-11-13-30-31(20-25)42-22-41-30)19-27(18-23)39-15-4-2-1-3-7-24-8-5-9-29(28(24)12-14-33(37)38)40-16-6-10-32(35)36/h5,8-9,11,13,17-20,34H,1-4,6-7,10,12,14-16,21-22H2,(H,35,36)(H,37,38) |
| InChIKey | ALMWAVRWDBKJHM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|