C36H40O7S — CID 46928987
4-[2-(2-carboxyethyl)-3-[6-(3-phenylmethoxy-5-thiophen-3-ylphenoxy)hexyl]phenoxy]butanoic acid (PubChem CID 46928987) has the molecular formula C36H40O7S and a molecular weight of 616.78 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-(3-phenylmethoxy-5-thiophen-3-ylphenoxy)hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-(3-phenylmethoxy-5-thiophen-3-ylphenoxy)hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46928987 |
| Molecular Formula | C36H40O7S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-(3-phenylmethoxy-5-thiophen-3-ylphenoxy)hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(OCc3ccccc3)cc(-c3ccsc3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C36H40O7S/c37-35(38)15-9-20-42-34-14-8-13-28(33(34)16-17-36(39)40)12-6-1-2-7-19-41-31-22-30(29-18-21-44-26-29)23-32(24-31)43-25-27-10-4-3-5-11-27/h3-5,8,10-11,13-14,18,21-24,26H,1-2,6-7,9,12,15-17,19-20,25H2,(H,37,38)(H,39,40) |
| InChIKey | NXOSHHBTDPEIDH-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|