C35H40O9 — CID 46929080
4-[3-[6-[3-acetyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 46929080) has the molecular formula C35H40O9 and a molecular weight of 604.70 g/mol. Its IUPAC name is 4-[3-[6-[3-acetyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-acetyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46929080 |
| Molecular Formula | C35H40O9 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 4-[3-[6-[3-acetyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | CC(=O)c1cc(OCCCCCCc2cccc(OCCCC(=O)O)c2CCC(=O)O)cc(-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C35H40O9/c1-24(36)27-20-28(26-12-14-32-33(23-26)44-19-18-43-32)22-29(21-27)41-16-5-3-2-4-8-25-9-6-10-31(30(25)13-15-35(39)40)42-17-7-11-34(37)38/h6,9-10,12,14,20-23H,2-5,7-8,11,13,15-19H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | YJXBBNJFAPFIRY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|