C38H45NO10 — CID 67339756
4-[2-(2-carboxyethyl)-3-[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(morpholine-4-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid (PubChem CID 67339756) has the molecular formula C38H45NO10 and a molecular weight of 675.77 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(morpholine-4-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(morpholine-4-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67339756 |
| Molecular Formula | C38H45NO10 |
| Molecular Weight | 675.77 g/mol |
| Exact Mass | 675.30 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(morpholine-4-carbonyl)phenoxy]hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(C(=O)N3CCOCC3)cc(-c3ccc4c(c3)OCCO4)c2)c1CCC(=O)O |
| InChI | InChI=1S/C38H45NO10/c40-36(41)10-6-18-47-33-9-5-8-27(32(33)12-14-37(42)43)7-3-1-2-4-17-46-31-24-29(28-11-13-34-35(26-28)49-22-21-48-34)23-30(25-31)38(44)39-15-19-45-20-16-39/h5,8-9,11,13,23-26H,1-4,6-7,10,12,14-22H2,(H,40,41)(H,42,43) |
| InChIKey | MKNSXMBKZRUDKN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.77 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|