C35H38N2O6 — CID 46888197
4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-pyrimidin-5-ylphenoxy)hexyl]phenoxy]butanoic acid (PubChem CID 46888197) has the molecular formula C35H38N2O6 and a molecular weight of 582.70 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-pyrimidin-5-ylphenoxy)hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-pyrimidin-5-ylphenoxy)hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46888197 |
| Molecular Formula | C35H38N2O6 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-(3-phenyl-5-pyrimidin-5-ylphenoxy)hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3cncnc3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C35H38N2O6/c38-34(39)15-9-19-43-33-14-8-13-27(32(33)16-17-35(40)41)12-4-1-2-7-18-42-31-21-28(26-10-5-3-6-11-26)20-29(22-31)30-23-36-25-37-24-30/h3,5-6,8,10-11,13-14,20-25H,1-2,4,7,9,12,15-19H2,(H,38,39)(H,40,41) |
| InChIKey | GRTVVRUMDLLTQV-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|