C39H42ClNO7 — CID 67339064
4-[3-[6-[3-(benzylcarbamoyl)-5-(2-chlorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 67339064) has the molecular formula C39H42ClNO7 and a molecular weight of 672.22 g/mol. Its IUPAC name is 4-[3-[6-[3-(benzylcarbamoyl)-5-(2-chlorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-(benzylcarbamoyl)-5-(2-chlorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67339064 |
| Molecular Formula | C39H42ClNO7 |
| Molecular Weight | 672.22 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | 4-[3-[6-[3-(benzylcarbamoyl)-5-(2-chlorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(C(=O)NCc3ccccc3)cc(-c3ccccc3Cl)c2)c1CCC(=O)O |
| InChI | InChI=1S/C39H42ClNO7/c40-35-17-8-7-16-33(35)30-24-31(39(46)41-27-28-12-4-3-5-13-28)26-32(25-30)47-22-9-2-1-6-14-29-15-10-18-36(34(29)20-21-38(44)45)48-23-11-19-37(42)43/h3-5,7-8,10,12-13,15-18,24-26H,1-2,6,9,11,14,19-23,27H2,(H,41,46)(H,42,43)(H,44,45) |
| InChIKey | XCBREVUFPARAFK-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.22 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|