C34H42FNO8 — CID 68733143
4-[2-(2-carboxyethyl)-3-[6-[3-(dimethylcarbamoyl)-5-(4-fluorophenyl)-1-hydroxycyclohexa-2,4-dien-1-yl]oxyhexyl]phenoxy]butanoic acid (PubChem CID 68733143) has the molecular formula C34H42FNO8 and a molecular weight of 611.71 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-[3-(dimethylcarbamoyl)-5-(4-fluorophenyl)-1-hydroxycyclohexa-2,4-dien-1-yl]oxyhexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(dimethylcarbamoyl)-5-(4-fluorophenyl)-1-hydroxycyclohexa-2,4-dien-1-yl]oxyhexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 68733143 |
| Molecular Formula | C34H42FNO8 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(dimethylcarbamoyl)-5-(4-fluorophenyl)-1-hydroxycyclohexa-2,4-dien-1-yl]oxyhexyl]phenoxy]butanoic acid |
| SMILES | CN(C)C(=O)C1=CC(O)(OCCCCCCc2cccc(OCCCC(=O)O)c2CCC(=O)O)CC(c2ccc(F)cc2)=C1 |
| InChI | InChI=1S/C34H42FNO8/c1-36(2)33(41)27-21-26(24-13-15-28(35)16-14-24)22-34(42,23-27)44-20-6-4-3-5-9-25-10-7-11-30(29(25)17-18-32(39)40)43-19-8-12-31(37)38/h7,10-11,13-16,21,23,42H,3-6,8-9,12,17-20,22H2,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | SUEHFWGJLUTRBG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|