C31H35FO8 — CID 10554772
5-[2-(2-carboxyethyl)-3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenoxy]pentanoic acid (PubChem CID 10554772) has the molecular formula C31H35FO8 and a molecular weight of 554.61 g/mol. Its IUPAC name is 5-[2-(2-carboxyethyl)-3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenoxy]pentanoic acid.
| Compound Name | 5-[2-(2-carboxyethyl)-3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 10554772 |
| Molecular Formula | C31H35FO8 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 5-[2-(2-carboxyethyl)-3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenoxy]pentanoic acid |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(O)cc1OCCCOc1cccc(OCCCCC(=O)O)c1CCC(=O)O |
| InChI | InChI=1S/C31H35FO8/c1-2-21-19-25(22-10-12-23(32)13-11-22)26(33)20-29(21)40-18-6-17-39-28-8-5-7-27(24(28)14-15-31(36)37)38-16-4-3-9-30(34)35/h5,7-8,10-13,19-20,33H,2-4,6,9,14-18H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | VJKKDGSKCGUCMP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|