C36H39FO6 — CID 10579225
methyl 2-[3-[5-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]pentoxy]-2-propylphenoxy]benzoate (PubChem CID 10579225) has the molecular formula C36H39FO6 and a molecular weight of 586.70 g/mol. Its IUPAC name is methyl 2-[3-[5-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]pentoxy]-2-propylphenoxy]benzoate.
| Compound Name | methyl 2-[3-[5-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]pentoxy]-2-propylphenoxy]benzoate |
|---|---|
| PubChem CID | 10579225 |
| Molecular Formula | C36H39FO6 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | methyl 2-[3-[5-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]pentoxy]-2-propylphenoxy]benzoate |
| SMILES | CCCc1c(OCCCCCOc2cc(O)c(-c3ccc(F)cc3)cc2CC)cccc1Oc1ccccc1C(=O)OC |
| InChI | InChI=1S/C36H39FO6/c1-4-12-28-32(15-11-16-33(28)43-34-14-8-7-13-29(34)36(39)40-3)41-21-9-6-10-22-42-35-24-31(38)30(23-25(35)5-2)26-17-19-27(37)20-18-26/h7-8,11,13-20,23-24,38H,4-6,9-10,12,21-22H2,1-3H3 |
| InChIKey | OSNPLSBBDMDRIG-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|