C28H31BrO5 — CID 142063876
methyl 2-[3-[3-(4-bromo-2-ethylphenoxy)propoxy]-2-propylphenoxy]benzoate (PubChem CID 142063876) has the molecular formula C28H31BrO5 and a molecular weight of 527.46 g/mol. Its IUPAC name is methyl 2-[3-[3-(4-bromo-2-ethylphenoxy)propoxy]-2-propylphenoxy]benzoate.
| Compound Name | methyl 2-[3-[3-(4-bromo-2-ethylphenoxy)propoxy]-2-propylphenoxy]benzoate |
|---|---|
| PubChem CID | 142063876 |
| Molecular Formula | C28H31BrO5 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | methyl 2-[3-[3-(4-bromo-2-ethylphenoxy)propoxy]-2-propylphenoxy]benzoate |
| SMILES | CCCc1c(OCCCOc2ccc(Br)cc2CC)cccc1Oc1ccccc1C(=O)OC |
| InChI | InChI=1S/C28H31BrO5/c1-4-10-22-25(33-18-9-17-32-24-16-15-21(29)19-20(24)5-2)13-8-14-26(22)34-27-12-7-6-11-23(27)28(30)31-3/h6-8,11-16,19H,4-5,9-10,17-18H2,1-3H3 |
| InChIKey | BPMZILARXUNEFS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|