C28H33N3O6S — CID 142063872
2-[3-[3-[4-[(Z)-C-aminosulfanylcarbonohydrazonoyl]-2-ethyl-5-hydroxyphenoxy]propoxy]-2-propylphenoxy]benzoic acid (PubChem CID 142063872) has the molecular formula C28H33N3O6S and a molecular weight of 539.65 g/mol. Its IUPAC name is 2-[3-[3-[4-[(Z)-C-aminosulfanylcarbonohydrazonoyl]-2-ethyl-5-hydroxyphenoxy]propoxy]-2-propylphenoxy]benzoic acid.
| Compound Name | 2-[3-[3-[4-[(Z)-C-aminosulfanylcarbonohydrazonoyl]-2-ethyl-5-hydroxyphenoxy]propoxy]-2-propylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 142063872 |
| Molecular Formula | C28H33N3O6S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-[3-[3-[4-[(Z)-C-aminosulfanylcarbonohydrazonoyl]-2-ethyl-5-hydroxyphenoxy]propoxy]-2-propylphenoxy]benzoic acid |
| SMILES | CCCc1c(OCCCOc2cc(O)c(/C(=N/N)SN)cc2CC)cccc1Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C28H33N3O6S/c1-3-9-19-23(12-7-13-24(19)37-25-11-6-5-10-20(25)28(33)34)35-14-8-15-36-26-17-22(32)21(16-18(26)4-2)27(31-29)38-30/h5-7,10-13,16-17,32H,3-4,8-9,14-15,29-30H2,1-2H3,(H,33,34)/b31-27- |
| InChIKey | DGJCHHBFNWDZNR-QVTSOHHYSA-N |
| XLogP | 5.47 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|