C34H35FO6 — CID 10578750
2-[3-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butoxy]-2-propylphenoxy]benzoic acid (PubChem CID 10578750) has the molecular formula C34H35FO6 and a molecular weight of 558.65 g/mol. Its IUPAC name is 2-[3-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butoxy]-2-propylphenoxy]benzoic acid.
| Compound Name | 2-[3-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butoxy]-2-propylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 10578750 |
| Molecular Formula | C34H35FO6 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 2-[3-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butoxy]-2-propylphenoxy]benzoic acid |
| SMILES | CCCc1c(OCCCCOc2cc(O)c(-c3ccc(F)cc3)cc2CC)cccc1Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C34H35FO6/c1-3-10-26-30(13-9-14-31(26)41-32-12-6-5-11-27(32)34(37)38)39-19-7-8-20-40-33-22-29(36)28(21-23(33)4-2)24-15-17-25(35)18-16-24/h5-6,9,11-18,21-22,36H,3-4,7-8,10,19-20H2,1-2H3,(H,37,38) |
| InChIKey | AKOVMIAPVGZJTL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|