C27H29FO6 — CID 19375778
methyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-6-hydroxyphenyl]propanoate (PubChem CID 19375778) has the molecular formula C27H29FO6 and a molecular weight of 468.52 g/mol. Its IUPAC name is methyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-6-hydroxyphenyl]propanoate.
| Compound Name | methyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-6-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 19375778 |
| Molecular Formula | C27H29FO6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-6-hydroxyphenyl]propanoate |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(O)cc1OCCCOc1cccc(O)c1CCC(=O)OC |
| InChI | InChI=1S/C27H29FO6/c1-3-18-16-22(19-8-10-20(28)11-9-19)24(30)17-26(18)34-15-5-14-33-25-7-4-6-23(29)21(25)12-13-27(31)32-2/h4,6-11,16-17,29-30H,3,5,12-15H2,1-2H3 |
| InChIKey | GYBQINJHPBAIGK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|