C26H27FN4O3 — CID 10695364
4-ethyl-2-(4-fluorophenyl)-5-[3-[2-[2-(2H-tetrazol-5-yl)ethyl]phenoxy]propoxy]phenol (PubChem CID 10695364) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 4-ethyl-2-(4-fluorophenyl)-5-[3-[2-[2-(2H-tetrazol-5-yl)ethyl]phenoxy]propoxy]phenol.
| Compound Name | 4-ethyl-2-(4-fluorophenyl)-5-[3-[2-[2-(2H-tetrazol-5-yl)ethyl]phenoxy]propoxy]phenol |
|---|---|
| PubChem CID | 10695364 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-ethyl-2-(4-fluorophenyl)-5-[3-[2-[2-(2H-tetrazol-5-yl)ethyl]phenoxy]propoxy]phenol |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(O)cc1OCCCOc1ccccc1CCc1nn[nH]n1 |
| InChI | InChI=1S/C26H27FN4O3/c1-2-18-16-22(19-8-11-21(27)12-9-19)23(32)17-25(18)34-15-5-14-33-24-7-4-3-6-20(24)10-13-26-28-30-31-29-26/h3-4,6-9,11-12,16-17,32H,2,5,10,13-15H2,1H3,(H,28,29,30,31) |
| InChIKey | UXECUVSLWWKGBH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|