C40H45FN4O6 — CID 11802820
ethyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-6-[4-(2H-tetrazol-5-yl)butoxy]phenyl]propanoate (PubChem CID 11802820) has the molecular formula C40H45FN4O6 and a molecular weight of 696.82 g/mol. Its IUPAC name is ethyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-6-[4-(2H-tetrazol-5-yl)butoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-6-[4-(2H-tetrazol-5-yl)butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 11802820 |
| Molecular Formula | C40H45FN4O6 |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | ethyl 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-6-[4-(2H-tetrazol-5-yl)butoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1c(OCCCCc2nn[nH]n2)cccc1OCCCOc1cc(OCc2ccccc2)c(-c2ccc(F)cc2)cc1CC |
| InChI | InChI=1S/C40H45FN4O6/c1-3-30-26-34(31-17-19-32(41)20-18-31)38(51-28-29-12-6-5-7-13-29)27-37(30)50-25-11-24-49-36-15-10-14-35(33(36)21-22-40(46)47-4-2)48-23-9-8-16-39-42-44-45-43-39/h5-7,10,12-15,17-20,26-27H,3-4,8-9,11,16,21-25,28H2,1-2H3,(H,42,43,44,45) |
| InChIKey | OMBHTYWIQXGDSE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|