C40H38F2O6 — CID 18754183
2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-2-propylphenoxy]-4-fluorobenzoic acid (PubChem CID 18754183) has the molecular formula C40H38F2O6 and a molecular weight of 652.73 g/mol. Its IUPAC name is 2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-2-propylphenoxy]-4-fluorobenzoic acid.
| Compound Name | 2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-2-propylphenoxy]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 18754183 |
| Molecular Formula | C40H38F2O6 |
| Molecular Weight | 652.73 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-2-propylphenoxy]-4-fluorobenzoic acid |
| SMILES | CCCc1c(OCCCOc2cc(OCc3ccccc3)c(-c3ccc(F)cc3)cc2CC)cccc1Oc1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C40H38F2O6/c1-3-10-32-35(13-8-14-36(32)48-39-24-31(42)19-20-33(39)40(43)44)45-21-9-22-46-37-25-38(47-26-27-11-6-5-7-12-27)34(23-28(37)4-2)29-15-17-30(41)18-16-29/h5-8,11-20,23-25H,3-4,9-10,21-22,26H2,1-2H3,(H,43,44) |
| InChIKey | SQCDPLAADSNZBQ-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.73 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|