C34H35FO5 — CID 10745069
2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoic acid (PubChem CID 10745069) has the molecular formula C34H35FO5 and a molecular weight of 542.65 g/mol. Its IUPAC name is 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoic acid.
| Compound Name | 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10745069 |
| Molecular Formula | C34H35FO5 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoic acid |
| SMILES | CCCc1c(Cc2ccccc2C(=O)O)cccc1OCCCOc1cc(O)c(-c2ccc(F)cc2)cc1CC |
| InChI | InChI=1S/C34H35FO5/c1-3-9-28-25(20-26-10-5-6-12-29(26)34(37)38)11-7-13-32(28)39-18-8-19-40-33-22-31(36)30(21-23(33)4-2)24-14-16-27(35)17-15-24/h5-7,10-17,21-22,36H,3-4,8-9,18-20H2,1-2H3,(H,37,38) |
| InChIKey | RNMNAOKPFGPBSK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|