C35H37FO5 — CID 10721539
methyl 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoate (PubChem CID 10721539) has the molecular formula C35H37FO5 and a molecular weight of 556.67 g/mol. Its IUPAC name is methyl 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoate.
| Compound Name | methyl 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoate |
|---|---|
| PubChem CID | 10721539 |
| Molecular Formula | C35H37FO5 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | methyl 2-[[3-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenyl]methyl]benzoate |
| SMILES | CCCc1c(Cc2ccccc2C(=O)OC)cccc1OCCCOc1cc(O)c(-c2ccc(F)cc2)cc1CC |
| InChI | InChI=1S/C35H37FO5/c1-4-10-29-26(21-27-11-6-7-13-30(27)35(38)39-3)12-8-14-33(29)40-19-9-20-41-34-23-32(37)31(22-24(34)5-2)25-15-17-28(36)18-16-25/h6-8,11-18,22-23,37H,4-5,9-10,19-21H2,1-3H3 |
| InChIKey | BVIRFFKDGZBVBO-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|