C26H28FNO4 — CID 140974164
3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenyl]propanamide (PubChem CID 140974164) has the molecular formula C26H28FNO4 and a molecular weight of 437.51 g/mol. Its IUPAC name is 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenyl]propanamide.
| Compound Name | 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 140974164 |
| Molecular Formula | C26H28FNO4 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-[2-[3-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]propoxy]phenyl]propanamide |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(O)cc1OCCCOc1ccccc1CCC(N)=O |
| InChI | InChI=1S/C26H28FNO4/c1-2-18-16-22(19-8-11-21(27)12-9-19)23(29)17-25(18)32-15-5-14-31-24-7-4-3-6-20(24)10-13-26(28)30/h3-4,6-9,11-12,16-17,29H,2,5,10,13-15H2,1H3,(H2,28,30) |
| InChIKey | PBARYRBFUMRPFI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|