C38H51NO8 — CID 142063902
tert-butyl 2-[3-ethyl-4-[3-[3-(2-methoxycarbonylphenoxy)-2-propylphenoxy]propoxy]phenyl]pyrrolidine-1-carboxylate;methanol (PubChem CID 142063902) has the molecular formula C38H51NO8 and a molecular weight of 649.83 g/mol. Its IUPAC name is tert-butyl 2-[3-ethyl-4-[3-[3-(2-methoxycarbonylphenoxy)-2-propylphenoxy]propoxy]phenyl]pyrrolidine-1-carboxylate;methanol.
| Compound Name | tert-butyl 2-[3-ethyl-4-[3-[3-(2-methoxycarbonylphenoxy)-2-propylphenoxy]propoxy]phenyl]pyrrolidine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 142063902 |
| Molecular Formula | C38H51NO8 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.36 |
| IUPAC Name | tert-butyl 2-[3-ethyl-4-[3-[3-(2-methoxycarbonylphenoxy)-2-propylphenoxy]propoxy]phenyl]pyrrolidine-1-carboxylate;methanol |
| SMILES | CCCc1c(OCCCOc2ccc(C3CCCN3C(=O)OC(C)(C)C)cc2CC)cccc1Oc1ccccc1C(=O)OC.CO |
| InChI | InChI=1S/C37H47NO7.CH4O/c1-7-14-28-32(18-11-19-33(28)44-34-17-10-9-15-29(34)35(39)41-6)43-24-13-23-42-31-21-20-27(25-26(31)8-2)30-16-12-22-38(30)36(40)45-37(3,4)5;1-2/h9-11,15,17-21,25,30H,7-8,12-14,16,22-24H2,1-6H3;2H,1H3 |
| InChIKey | VHOLSHJGSBJNKE-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|