C18H27NO4 — CID 102390009
tert-butyl 2-(3,4-dimethoxyphenyl)piperidine-1-carboxylate (PubChem CID 102390009) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dimethoxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3,4-dimethoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102390009 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl 2-(3,4-dimethoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccc(C2CCCCN2C(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C18H27NO4/c1-18(2,3)23-17(20)19-11-7-6-8-14(19)13-9-10-15(21-4)16(12-13)22-5/h9-10,12,14H,6-8,11H2,1-5H3 |
| InChIKey | MXHHRPRVUMCTRO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |