C30H41NO5 — CID 19598025
3-[2-[6-(dimethylamino)-6-oxohexyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 19598025) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is 3-[2-[6-(dimethylamino)-6-oxohexyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[6-(dimethylamino)-6-oxohexyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19598025 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 3-[2-[6-(dimethylamino)-6-oxohexyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2cccc(CCCCCC(=O)N(C)C)c2CCC(=O)O)cc1 |
| InChI | InChI=1S/C30H41NO5/c1-31(2)29(32)16-9-6-8-13-25-14-11-15-28(27(25)21-22-30(33)34)36-23-10-5-4-7-12-24-17-19-26(35-3)20-18-24/h7,11-12,14-15,17-20H,4-6,8-10,13,16,21-23H2,1-3H3,(H,33,34)/b12-7+ |
| InChIKey | FFBONUFAUYDASL-KPKJPENVSA-N |
| XLogP | 6.17 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|