C24H31NO8S2 — CID 19598038
3-[2-[bis(methylsulfonyl)amino]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 19598038) has the molecular formula C24H31NO8S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 3-[2-[bis(methylsulfonyl)amino]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[bis(methylsulfonyl)amino]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19598038 |
| Molecular Formula | C24H31NO8S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 3-[2-[bis(methylsulfonyl)amino]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2cccc(N(S(C)(=O)=O)S(C)(=O)=O)c2CCC(=O)O)cc1 |
| InChI | InChI=1S/C24H31NO8S2/c1-32-20-14-12-19(13-15-20)9-6-4-5-7-18-33-23-11-8-10-22(21(23)16-17-24(26)27)25(34(2,28)29)35(3,30)31/h6,8-15H,4-5,7,16-18H2,1-3H3,(H,26,27)/b9-6+ |
| InChIKey | MAEBOTZTLVSCNW-RMKNXTFCSA-N |
| XLogP | 3.70 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|