C29H33NO6S — CID 15435855
3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-[(4-methylphenyl)sulfonylamino]phenyl]propanoic acid (PubChem CID 15435855) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is 3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-[(4-methylphenyl)sulfonylamino]phenyl]propanoic acid.
| Compound Name | 3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-[(4-methylphenyl)sulfonylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 15435855 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-[(4-methylphenyl)sulfonylamino]phenyl]propanoic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C29H33NO6S/c1-22-8-16-27(17-9-22)37(33,34)30-25-13-18-28(24(21-25)12-19-29(31)32)36-20-6-4-3-5-7-23-10-14-26(35-2)15-11-23/h5,7-11,13-18,21,30H,3-4,6,12,19-20H2,1-2H3,(H,31,32)/b7-5+ |
| InChIKey | BPODFFHSIHAOAV-FNORWQNLSA-N |
| XLogP | 6.08 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|