C27H29NO7S2 — CID 146319173
3-[2-[(E)-5-[3-(benzenesulfonamido)-4-methylsulfonylphenyl]pent-4-enoxy]phenyl]propanoic acid (PubChem CID 146319173) has the molecular formula C27H29NO7S2 and a molecular weight of 543.66 g/mol. Its IUPAC name is 3-[2-[(E)-5-[3-(benzenesulfonamido)-4-methylsulfonylphenyl]pent-4-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[(E)-5-[3-(benzenesulfonamido)-4-methylsulfonylphenyl]pent-4-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146319173 |
| Molecular Formula | C27H29NO7S2 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 3-[2-[(E)-5-[3-(benzenesulfonamido)-4-methylsulfonylphenyl]pent-4-enoxy]phenyl]propanoic acid |
| SMILES | CS(=O)(=O)c1ccc(/C=C/CCCOc2ccccc2CCC(=O)O)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29NO7S2/c1-36(31,32)26-17-15-21(20-24(26)28-37(33,34)23-12-5-2-6-13-23)10-4-3-9-19-35-25-14-8-7-11-22(25)16-18-27(29)30/h2,4-8,10-15,17,20,28H,3,9,16,18-19H2,1H3,(H,29,30)/b10-4+ |
| InChIKey | WQMJLWMVSVVZSD-ONNFQVAWSA-N |
| XLogP | 4.78 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|