C26H35NO5S — CID 153399395
3-[2-[5-[4-(benzenesulfonamido)cyclohexyl]pentoxy]phenyl]propanoic acid (PubChem CID 153399395) has the molecular formula C26H35NO5S and a molecular weight of 473.64 g/mol. Its IUPAC name is 3-[2-[5-[4-(benzenesulfonamido)cyclohexyl]pentoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[5-[4-(benzenesulfonamido)cyclohexyl]pentoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 153399395 |
| Molecular Formula | C26H35NO5S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 3-[2-[5-[4-(benzenesulfonamido)cyclohexyl]pentoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1OCCCCCC1CCC(NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H35NO5S/c28-26(29)19-16-22-10-6-7-13-25(22)32-20-8-2-3-9-21-14-17-23(18-15-21)27-33(30,31)24-11-4-1-5-12-24/h1,4-7,10-13,21,23,27H,2-3,8-9,14-20H2,(H,28,29) |
| InChIKey | MRIAHZYVTQCDBW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|