C27H26O8S — CID 15115489
3-[4-[4-(benzenesulfonyl)butoxy]-3-(2-carboxyethyl)benzoyl]benzoic acid (PubChem CID 15115489) has the molecular formula C27H26O8S and a molecular weight of 510.56 g/mol. Its IUPAC name is 3-[4-[4-(benzenesulfonyl)butoxy]-3-(2-carboxyethyl)benzoyl]benzoic acid.
| Compound Name | 3-[4-[4-(benzenesulfonyl)butoxy]-3-(2-carboxyethyl)benzoyl]benzoic acid |
|---|---|
| PubChem CID | 15115489 |
| Molecular Formula | C27H26O8S |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 3-[4-[4-(benzenesulfonyl)butoxy]-3-(2-carboxyethyl)benzoyl]benzoic acid |
| SMILES | O=C(O)CCc1cc(C(=O)c2cccc(C(=O)O)c2)ccc1OCCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26O8S/c28-25(29)14-12-19-17-21(26(30)20-7-6-8-22(18-20)27(31)32)11-13-24(19)35-15-4-5-16-36(33,34)23-9-2-1-3-10-23/h1-3,6-11,13,17-18H,4-5,12,14-16H2,(H,28,29)(H,31,32) |
| InChIKey | VLFJXXAIDHNPKV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|