C27H35NO6 — CID 19745175
3-[(Z)-C-[3-(2-carboxyethyl)-4-decoxyphenyl]-N-hydroxycarbonimidoyl]benzoic acid (PubChem CID 19745175) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is 3-[(Z)-C-[3-(2-carboxyethyl)-4-decoxyphenyl]-N-hydroxycarbonimidoyl]benzoic acid.
| Compound Name | 3-[(Z)-C-[3-(2-carboxyethyl)-4-decoxyphenyl]-N-hydroxycarbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 19745175 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 3-[(Z)-C-[3-(2-carboxyethyl)-4-decoxyphenyl]-N-hydroxycarbonimidoyl]benzoic acid |
| SMILES | CCCCCCCCCCOc1ccc(/C(=N/O)c2cccc(C(=O)O)c2)cc1CCC(=O)O |
| InChI | InChI=1S/C27H35NO6/c1-2-3-4-5-6-7-8-9-17-34-24-15-13-22(18-20(24)14-16-25(29)30)26(28-33)21-11-10-12-23(19-21)27(31)32/h10-13,15,18-19,33H,2-9,14,16-17H2,1H3,(H,29,30)(H,31,32)/b28-26+ |
| InChIKey | QNIKMCLYIMCMBJ-BYCLXTJYSA-N |
| XLogP | 6.15 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|