C30H30O7S — CID 14739825
3-[3-(2-carboxyethyl)-4-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]benzoyl]benzoic acid (PubChem CID 14739825) has the molecular formula C30H30O7S and a molecular weight of 534.63 g/mol. Its IUPAC name is 3-[3-(2-carboxyethyl)-4-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]benzoyl]benzoic acid.
| Compound Name | 3-[3-(2-carboxyethyl)-4-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]benzoyl]benzoic acid |
|---|---|
| PubChem CID | 14739825 |
| Molecular Formula | C30H30O7S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 3-[3-(2-carboxyethyl)-4-[(E)-6-(4-methylsulfinylphenyl)hex-5-enoxy]benzoyl]benzoic acid |
| SMILES | CS(=O)c1ccc(/C=C/CCCCOc2ccc(C(=O)c3cccc(C(=O)O)c3)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C30H30O7S/c1-38(36)26-14-10-21(11-15-26)7-4-2-3-5-18-37-27-16-12-24(19-22(27)13-17-28(31)32)29(33)23-8-6-9-25(20-23)30(34)35/h4,6-12,14-16,19-20H,2-3,5,13,17-18H2,1H3,(H,31,32)(H,34,35)/b7-4+ |
| InChIKey | DKCYCURZFYCADF-QPJJXVBHSA-N |
| XLogP | 5.63 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|