C29H38N2O5S — CID 19598021
3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-6-(4-methylsulfanylphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 19598021) has the molecular formula C29H38N2O5S and a molecular weight of 526.70 g/mol. Its IUPAC name is 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-6-(4-methylsulfanylphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-6-(4-methylsulfanylphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19598021 |
| Molecular Formula | C29H38N2O5S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-6-(4-methylsulfanylphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | CSc1ccc(/C=C/CCCCOc2ccc(NC(=O)CCCC(=O)N(C)C)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C29H38N2O5S/c1-31(2)28(33)11-8-10-27(32)30-24-15-18-26(23(21-24)14-19-29(34)35)36-20-7-5-4-6-9-22-12-16-25(37-3)17-13-22/h6,9,12-13,15-18,21H,4-5,7-8,10-11,14,19-20H2,1-3H3,(H,30,32)(H,34,35)/b9-6+ |
| InChIKey | OJBHWLVOQMMUPN-RMKNXTFCSA-N |
| XLogP | 5.89 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|