C32H52N2O6 — CID 19598005
methyl 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-7-hydroxypentadec-5-enoxy]phenyl]propanoate (PubChem CID 19598005) has the molecular formula C32H52N2O6 and a molecular weight of 560.78 g/mol. Its IUPAC name is methyl 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-7-hydroxypentadec-5-enoxy]phenyl]propanoate.
| Compound Name | methyl 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-7-hydroxypentadec-5-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 19598005 |
| Molecular Formula | C32H52N2O6 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | methyl 3-[5-[[5-(dimethylamino)-5-oxopentanoyl]amino]-2-[(E)-7-hydroxypentadec-5-enoxy]phenyl]propanoate |
| SMILES | CCCCCCCCC(O)/C=C/CCCCOc1ccc(NC(=O)CCCC(=O)N(C)C)cc1CCC(=O)OC |
| InChI | InChI=1S/C32H52N2O6/c1-5-6-7-8-9-12-16-28(35)17-13-10-11-14-24-40-29-22-21-27(25-26(29)20-23-32(38)39-4)33-30(36)18-15-19-31(37)34(2)3/h13,17,21-22,25,28,35H,5-12,14-16,18-20,23-24H2,1-4H3,(H,33,36)/b17-13+ |
| InChIKey | QZQDDKFIEPOYDY-GHRIWEEISA-N |
| XLogP | 6.21 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|