C32H53NO6 — CID 54550077
3-[5-[5-(dimethylamino)-5-oxopentoxy]-2-(7-hydroxy-6-methylpentadec-5-enoxy)phenyl]propanoic acid (PubChem CID 54550077) has the molecular formula C32H53NO6 and a molecular weight of 547.78 g/mol. Its IUPAC name is 3-[5-[5-(dimethylamino)-5-oxopentoxy]-2-(7-hydroxy-6-methylpentadec-5-enoxy)phenyl]propanoic acid.
| Compound Name | 3-[5-[5-(dimethylamino)-5-oxopentoxy]-2-(7-hydroxy-6-methylpentadec-5-enoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54550077 |
| Molecular Formula | C32H53NO6 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.39 |
| IUPAC Name | 3-[5-[5-(dimethylamino)-5-oxopentoxy]-2-(7-hydroxy-6-methylpentadec-5-enoxy)phenyl]propanoic acid |
| SMILES | CCCCCCCCC(O)C(C)=CCCCCOc1ccc(OCCCCC(=O)N(C)C)cc1CCC(=O)O |
| InChI | InChI=1S/C32H53NO6/c1-5-6-7-8-9-12-17-29(34)26(2)16-11-10-14-24-39-30-21-20-28(25-27(30)19-22-32(36)37)38-23-15-13-18-31(35)33(3)4/h16,20-21,25,29,34H,5-15,17-19,22-24H2,1-4H3,(H,36,37) |
| InChIKey | ZJHCKDWFQHFYSF-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|