C14H21NO2 — CID 142596913
N,N-dimethyl-6-phenoxyhexanamide (PubChem CID 142596913) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N,N-dimethyl-6-phenoxyhexanamide.
| Compound Name | N,N-dimethyl-6-phenoxyhexanamide |
|---|---|
| PubChem CID | 142596913 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N,N-dimethyl-6-phenoxyhexanamide |
| SMILES | CN(C)C(=O)CCCCCOc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-15(2)14(16)11-7-4-8-12-17-13-9-5-3-6-10-13/h3,5-6,9-10H,4,7-8,11-12H2,1-2H3 |
| InChIKey | YCVGWZUKHACHPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|