C40H64O6 — CID 70019226
3-(2,5-dipentoxyphenyl)-1-(2,3,5-tripentoxyphenyl)propan-1-one (PubChem CID 70019226) has the molecular formula C40H64O6 and a molecular weight of 640.95 g/mol. Its IUPAC name is 3-(2,5-dipentoxyphenyl)-1-(2,3,5-tripentoxyphenyl)propan-1-one.
| Compound Name | 3-(2,5-dipentoxyphenyl)-1-(2,3,5-tripentoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 70019226 |
| Molecular Formula | C40H64O6 |
| Molecular Weight | 640.95 g/mol |
| Exact Mass | 640.47 |
| IUPAC Name | 3-(2,5-dipentoxyphenyl)-1-(2,3,5-tripentoxyphenyl)propan-1-one |
| SMILES | CCCCCOc1ccc(OCCCCC)c(CCC(=O)c2cc(OCCCCC)cc(OCCCCC)c2OCCCCC)c1 |
| InChI | InChI=1S/C40H64O6/c1-6-11-16-25-42-34-22-24-38(44-27-18-13-8-3)33(30-34)21-23-37(41)36-31-35(43-26-17-12-7-2)32-39(45-28-19-14-9-4)40(36)46-29-20-15-10-5/h22,24,30-32H,6-21,23,25-29H2,1-5H3 |
| InChIKey | CIOGZLUONYRYBW-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.95 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|