C28H40O6 — CID 70017411
1-(2,3-dipropoxyphenyl)-3-(3-methoxy-2,5-dipropoxyphenyl)propan-1-one (PubChem CID 70017411) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is 1-(2,3-dipropoxyphenyl)-3-(3-methoxy-2,5-dipropoxyphenyl)propan-1-one.
| Compound Name | 1-(2,3-dipropoxyphenyl)-3-(3-methoxy-2,5-dipropoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 70017411 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-(2,3-dipropoxyphenyl)-3-(3-methoxy-2,5-dipropoxyphenyl)propan-1-one |
| SMILES | CCCOc1cc(CCC(=O)c2cccc(OCCC)c2OCCC)c(OCCC)c(OC)c1 |
| InChI | InChI=1S/C28H40O6/c1-6-15-31-22-19-21(27(33-17-8-3)26(20-22)30-5)13-14-24(29)23-11-10-12-25(32-16-7-2)28(23)34-18-9-4/h10-12,19-20H,6-9,13-18H2,1-5H3 |
| InChIKey | DYRZXYVDEFUARE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |